C8H16BrNO — CID 162749116
3-bromo-5-propan-2-yl-4,5-dihydro-1,2-oxazole;ethane (PubChem CID 162749116) has the molecular formula C8H16BrNO and a molecular weight of 222.13 g/mol. Its IUPAC name is 3-bromo-5-propan-2-yl-4,5-dihydro-1,2-oxazole;ethane.
| Compound Name | 3-bromo-5-propan-2-yl-4,5-dihydro-1,2-oxazole;ethane |
|---|---|
| PubChem CID | 162749116 |
| Molecular Formula | C8H16BrNO |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 3-bromo-5-propan-2-yl-4,5-dihydro-1,2-oxazole;ethane |
| SMILES | CC.CC(C)C1CC(Br)=NO1 |
| InChI | InChI=1S/C6H10BrNO.C2H6/c1-4(2)5-3-6(7)8-9-5;1-2/h4-5H,3H2,1-2H3;1-2H3 |
| InChIKey | OHFMOXXIXGVXDJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |