About 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane
3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane (PubChem CID 155732712) has the molecular formula C9H18BrNO
and a molecular weight of 236.15 g/mol. Its IUPAC name is 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane.
Molecular Properties
| Compound Name | 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane |
| PubChem CID | 155732712 |
| Molecular Formula | C9H18BrNO |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane |
| SMILES | CC.CC(C)C1(C)CC(Br)=NO1 |
| InChI | InChI=1S/C7H12BrNO.C2H6/c1-5(2)7(3)4-6(8)9-10-7;1-2/h5H,4H2,1-3H3;1-2H3 |
| InChIKey | QMEJYAQBFCJAEB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane?
The IUPAC name of 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane (CID 155732712) is 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane.
What is the SMILES notation for 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane?
The canonical SMILES for 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane is CC.CC(C)C1(C)CC(Br)=NO1.
What is the InChIKey of 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane?
The InChIKey is QMEJYAQBFCJAEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12BrNO.C2H6/c1-5(2)7(3)4-6(8)9-10-7;1-2/h5H,4H2,1-3H3;1-2H3.
What are the key properties of 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane?
3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane has a molecular weight of 236.15 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-methyl-5-propan-2-yl-4H-1,2-oxazole;ethane is sourced from PubChem (CID 155732712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).