C15H32OSi2 — CID 10469147
[2-ethyl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl-trimethylsilane (PubChem CID 10469147) has the molecular formula C15H32OSi2 and a molecular weight of 284.59 g/mol. Its IUPAC name is [2-ethyl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl-trimethylsilane.
| Compound Name | [2-ethyl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 10469147 |
| Molecular Formula | C15H32OSi2 |
| Molecular Weight | 284.59 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | [2-ethyl-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl-trimethylsilane |
| SMILES | CCC1CC(C[Si](C)(C)C)=C(C[Si](C)(C)C)CO1 |
| InChI | InChI=1S/C15H32OSi2/c1-8-15-9-13(11-17(2,3)4)14(10-16-15)12-18(5,6)7/h15H,8-12H2,1-7H3 |
| InChIKey | TZRIBUMJPBNNCL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|