C17H36OSi2 — CID 10086909
trimethyl-[[2-(2-methylpropyl)-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl]silane (PubChem CID 10086909) has the molecular formula C17H36OSi2 and a molecular weight of 312.65 g/mol. Its IUPAC name is trimethyl-[[2-(2-methylpropyl)-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl]silane.
| Compound Name | trimethyl-[[2-(2-methylpropyl)-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl]silane |
|---|---|
| PubChem CID | 10086909 |
| Molecular Formula | C17H36OSi2 |
| Molecular Weight | 312.65 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | trimethyl-[[2-(2-methylpropyl)-4-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-5-yl]methyl]silane |
| SMILES | CC(C)CC1CC(C[Si](C)(C)C)=C(C[Si](C)(C)C)CO1 |
| InChI | InChI=1S/C17H36OSi2/c1-14(2)9-17-10-15(12-19(3,4)5)16(11-18-17)13-20(6,7)8/h14,17H,9-13H2,1-8H3 |
| InChIKey | OBGUGEFMNUGVRF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|