C15H32OSi2 — CID 10107975
[6,6-dimethyl-3-(trimethylsilylmethyl)-2,5-dihydropyran-4-yl]methyl-trimethylsilane (PubChem CID 10107975) has the molecular formula C15H32OSi2 and a molecular weight of 284.59 g/mol. Its IUPAC name is [6,6-dimethyl-3-(trimethylsilylmethyl)-2,5-dihydropyran-4-yl]methyl-trimethylsilane.
| Compound Name | [6,6-dimethyl-3-(trimethylsilylmethyl)-2,5-dihydropyran-4-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 10107975 |
| Molecular Formula | C15H32OSi2 |
| Molecular Weight | 284.59 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | [6,6-dimethyl-3-(trimethylsilylmethyl)-2,5-dihydropyran-4-yl]methyl-trimethylsilane |
| SMILES | CC1(C)CC(C[Si](C)(C)C)=C(C[Si](C)(C)C)CO1 |
| InChI | InChI=1S/C15H32OSi2/c1-15(2)9-13(11-17(3,4)5)14(10-16-15)12-18(6,7)8/h9-12H2,1-8H3 |
| InChIKey | DHFYNWLZFAEOLK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|