C22H36OSi2 — CID 15430735
[(2E,9E)-2,10-dimethyl-9-trimethylsilyl-6-oxatricyclo[9.4.0.04,8]pentadeca-1(11),2,4(8),9-tetraen-3-yl]-trimethylsilane (PubChem CID 15430735) has the molecular formula C22H36OSi2 and a molecular weight of 372.70 g/mol. Its IUPAC name is [(2E,9E)-2,10-dimethyl-9-trimethylsilyl-6-oxatricyclo[9.4.0.04,8]pentadeca-1(11),2,4(8),9-tetraen-3-yl]-trimethylsilane.
| Compound Name | [(2E,9E)-2,10-dimethyl-9-trimethylsilyl-6-oxatricyclo[9.4.0.04,8]pentadeca-1(11),2,4(8),9-tetraen-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 15430735 |
| Molecular Formula | C22H36OSi2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(2E,9E)-2,10-dimethyl-9-trimethylsilyl-6-oxatricyclo[9.4.0.04,8]pentadeca-1(11),2,4(8),9-tetraen-3-yl]-trimethylsilane |
| SMILES | C/C1=C(\[Si](C)(C)C)C2=C(COC2)/C([Si](C)(C)C)=C(/C)C2=C1CCCC2 |
| InChI | InChI=1S/C22H36OSi2/c1-15-17-11-9-10-12-18(17)16(2)22(25(6,7)8)20-14-23-13-19(20)21(15)24(3,4)5/h9-14H2,1-8H3/b17-15-,18-16-,21-15+,21-19+,22-16+,22-20+ |
| InChIKey | ZWZRTKCLGBWIAD-PMVISCKTSA-N |
| XLogP | 6.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|