C26H46OSi2 — CID 15430740
[(4E,6Z,8E)-7,8-diethyl-5,6-dipropyl-4-trimethylsilyl-1,3-dihydrocycloocta[c]furan-9-yl]-trimethylsilane (PubChem CID 15430740) has the molecular formula C26H46OSi2 and a molecular weight of 430.83 g/mol. Its IUPAC name is [(4E,6Z,8E)-7,8-diethyl-5,6-dipropyl-4-trimethylsilyl-1,3-dihydrocycloocta[c]furan-9-yl]-trimethylsilane.
| Compound Name | [(4E,6Z,8E)-7,8-diethyl-5,6-dipropyl-4-trimethylsilyl-1,3-dihydrocycloocta[c]furan-9-yl]-trimethylsilane |
|---|---|
| PubChem CID | 15430740 |
| Molecular Formula | C26H46OSi2 |
| Molecular Weight | 430.83 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | [(4E,6Z,8E)-7,8-diethyl-5,6-dipropyl-4-trimethylsilyl-1,3-dihydrocycloocta[c]furan-9-yl]-trimethylsilane |
| SMILES | CCCC1=C(CC)/C(CC)=C(/[Si](C)(C)C)C2=C(COC2)/C([Si](C)(C)C)=C\1CCC |
| InChI | InChI=1S/C26H46OSi2/c1-11-15-21-19(13-3)20(14-4)25(28(5,6)7)23-17-27-18-24(23)26(29(8,9)10)22(21)16-12-2/h11-18H2,1-10H3/b20-19-,21-19-,22-21-,25-20+,25-23+,26-22+,26-24+ |
| InChIKey | RGORTJABMZXIPY-BAOWYBJXSA-N |
| XLogP | 8.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.83 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|