C24H44O2Si4 — CID 100951043
trimethyl-[(2Z,9Z)-3,9,10-tris(trimethylsilyl)-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraen-2-yl]silane (PubChem CID 100951043) has the molecular formula C24H44O2Si4 and a molecular weight of 476.96 g/mol. Its IUPAC name is trimethyl-[(2Z,9Z)-3,9,10-tris(trimethylsilyl)-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraen-2-yl]silane.
| Compound Name | trimethyl-[(2Z,9Z)-3,9,10-tris(trimethylsilyl)-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraen-2-yl]silane |
|---|---|
| PubChem CID | 100951043 |
| Molecular Formula | C24H44O2Si4 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | trimethyl-[(2Z,9Z)-3,9,10-tris(trimethylsilyl)-6,13-dioxatricyclo[9.3.0.04,8]tetradeca-1(11),2,4(8),9-tetraen-2-yl]silane |
| SMILES | C[Si](C)(C)/C1=C(\[Si](C)(C)C)C2=C(COC2)/C([Si](C)(C)C)=C(/[Si](C)(C)C)C2=C1COC2 |
| InChI | InChI=1S/C24H44O2Si4/c1-27(2,3)21-17-13-25-14-18(17)23(29(7,8)9)24(30(10,11)12)20-16-26-15-19(20)22(21)28(4,5)6/h13-16H2,1-12H3/b21-17+,22-19+,22-21-,23-18+,24-20+,24-23- |
| InChIKey | JKNMKAJJEBKZKF-ZETWBMFLSA-N |
| XLogP | 6.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|