C24H42OSi2 — CID 15972072
[(3aZ,5Z,7Z,9Z)-5,6,7,8-tetraethyl-4-trimethylsilyl-1,3-dihydrocycloocta[c]furan-9-yl]-trimethylsilane (PubChem CID 15972072) has the molecular formula C24H42OSi2 and a molecular weight of 402.77 g/mol. Its IUPAC name is [(3aZ,5Z,7Z,9Z)-5,6,7,8-tetraethyl-4-trimethylsilyl-1,3-dihydrocycloocta[c]furan-9-yl]-trimethylsilane.
| Compound Name | [(3aZ,5Z,7Z,9Z)-5,6,7,8-tetraethyl-4-trimethylsilyl-1,3-dihydrocycloocta[c]furan-9-yl]-trimethylsilane |
|---|---|
| PubChem CID | 15972072 |
| Molecular Formula | C24H42OSi2 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | [(3aZ,5Z,7Z,9Z)-5,6,7,8-tetraethyl-4-trimethylsilyl-1,3-dihydrocycloocta[c]furan-9-yl]-trimethylsilane |
| SMILES | CCC1=C(CC)/C([Si](C)(C)C)=C2/COC/C2=C([Si](C)(C)C)/C(CC)=C\1CC |
| InChI | InChI=1S/C24H42OSi2/c1-11-17-18(12-2)20(14-4)24(27(8,9)10)22-16-25-15-21(22)23(19(17)13-3)26(5,6)7/h11-16H2,1-10H3/b18-17-,19-17-,20-18-,23-19+,23-21+,24-20+,24-22+ |
| InChIKey | ZZKXOIRQTMQHGI-OARHRTAQSA-N |
| XLogP | 7.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|