About 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane
2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane (PubChem CID 68656412) has the molecular formula C27H48OSi
and a molecular weight of 416.77 g/mol. Its IUPAC name is 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane |
| PubChem CID | 68656412 |
| Molecular Formula | C27H48OSi |
| Molecular Weight | 416.77 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CCCCC(CC)COC1(C#C[Si](C(C)C)(C(C)C)C(C)C)C=C(C)C=C(C)C1 |
| InChI | InChI=1S/C27H48OSi/c1-11-13-14-26(12-2)20-28-27(18-24(9)17-25(10)19-27)15-16-29(21(3)4,22(5)6)23(7)8/h17-18,21-23,26H,11-14,19-20H2,1-10H3 |
| InChIKey | SVNLUIOTWPWWND-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.77 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane?
The IUPAC name of 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane (CID 68656412) is 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane.
What is the SMILES notation for 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane?
The canonical SMILES for 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane is CCCCC(CC)COC1(C#C[Si](C(C)C)(C(C)C)C(C)C)C=C(C)C=C(C)C1.
What is the InChIKey of 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane?
The InChIKey is SVNLUIOTWPWWND-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H48OSi/c1-11-13-14-26(12-2)20-28-27(18-24(9)17-25(10)19-27)15-16-29(21(3)4,22(5)6)23(7)8/h17-18,21-23,26H,11-14,19-20H2,1-10H3.
What are the key properties of 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane?
2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane has a molecular weight of 416.77 g/mol, XLogP of 8.48, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-ethylhexoxy)-3,5-dimethylcyclohexa-2,4-dien-1-yl]ethynyl-tri(propan-2-yl)silane is sourced from PubChem (CID 68656412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).