C22H38O2Si — CID 102371774
3-[(1S,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]butan-1-ol (PubChem CID 102371774) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is 3-[(1S,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]butan-1-ol.
| Compound Name | 3-[(1S,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 102371774 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 3-[(1S,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]butan-1-ol |
| SMILES | CC1=CC[C@H](C(C)C)[C@@H]2[C@H]1[C@@H](CC#C[Si](C)(C)C)O[C@H]2C(C)CCO |
| InChI | InChI=1S/C22H38O2Si/c1-15(2)18-11-10-16(3)20-19(9-8-14-25(5,6)7)24-22(21(18)20)17(4)12-13-23/h10,15,17-23H,9,11-13H2,1-7H3/t17?,18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | IXZAOAZGERIUFR-LTOWJXQQSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|