C18H30O2Si — CID 59976727
(7aS)-1-[(2R)-3-hydroxy-5-trimethylsilylpent-4-yn-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 59976727) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is (7aS)-1-[(2R)-3-hydroxy-5-trimethylsilylpent-4-yn-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | (7aS)-1-[(2R)-3-hydroxy-5-trimethylsilylpent-4-yn-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 59976727 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (7aS)-1-[(2R)-3-hydroxy-5-trimethylsilylpent-4-yn-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | C[C@H](C1=CCC2C(O)CCC[C@]12C)C(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H30O2Si/c1-13(16(19)10-12-21(3,4)5)14-8-9-15-17(20)7-6-11-18(14,15)2/h8,13,15-17,19-20H,6-7,9,11H2,1-5H3/t13-,15?,16?,17?,18-/m1/s1 |
| InChIKey | SKMTZLOBQWGZLM-MRQFFAIMSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|