C18H30OSi — CID 14801283
[(3aR,4S,7aS)-7a-methyl-1-[(2R)-pent-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane (PubChem CID 14801283) has the molecular formula C18H30OSi and a molecular weight of 290.52 g/mol. Its IUPAC name is [(3aR,4S,7aS)-7a-methyl-1-[(2R)-pent-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane.
| Compound Name | [(3aR,4S,7aS)-7a-methyl-1-[(2R)-pent-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 14801283 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | [(3aR,4S,7aS)-7a-methyl-1-[(2R)-pent-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane |
| SMILES | C#CC[C@@H](C)C1=CC[C@H]2[C@@H](O[Si](C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C18H30OSi/c1-7-9-14(2)15-11-12-16-17(19-20(4,5)6)10-8-13-18(15,16)3/h1,11,14,16-17H,8-10,12-13H2,2-6H3/t14-,16+,17+,18-/m1/s1 |
| InChIKey | OAEIGYNVQRULEG-LAVFITLUSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|