C20H34OSi — CID 102085280
[(1S,4aS,8aS)-8a-methyl-4a-prop-2-ynyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102085280) has the molecular formula C20H34OSi and a molecular weight of 318.58 g/mol. Its IUPAC name is [(1S,4aS,8aS)-8a-methyl-4a-prop-2-ynyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,4aS,8aS)-8a-methyl-4a-prop-2-ynyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102085280 |
| Molecular Formula | C20H34OSi |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | [(1S,4aS,8aS)-8a-methyl-4a-prop-2-ynyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C#CC[C@@]12C=CCC[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CCC2 |
| InChI | InChI=1S/C20H34OSi/c1-8-13-20-15-10-9-14-19(20,5)17(12-11-16-20)21-22(6,7)18(2,3)4/h1,10,15,17H,9,11-14,16H2,2-7H3/t17-,19+,20-/m0/s1 |
| InChIKey | NVTSKKFTIGTHSN-SXLOBPIMSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|