C18H31OSi — CID 18709860
CID 18709860 (PubChem CID 18709860) has the molecular formula C18H31OSi and a molecular weight of 291.53 g/mol.
| Compound Name | CID 18709860 |
|---|---|
| PubChem CID | 18709860 |
| Molecular Formula | C18H31OSi |
| Molecular Weight | 291.53 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | — |
| SMILES | C=[Si]OC1CCC2=CC(C)C(C(C)(C)C)CC2(C)C1C |
| InChI | InChI=1S/C18H31OSi/c1-12-10-14-8-9-16(19-20-7)13(2)18(14,6)11-15(12)17(3,4)5/h10,12-13,15-16H,7-9,11H2,1-6H3 |
| InChIKey | JNDAVGTXFUSAFA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|