C24H44OSi2 — CID 155933466
[(2S,4aR,8aR)-1,1,4a-trimethyl-6-(2-trimethylsilylethynyl)-2,3,4,7,8,8a-hexahydronaphthalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 155933466) has the molecular formula C24H44OSi2 and a molecular weight of 404.79 g/mol. Its IUPAC name is [(2S,4aR,8aR)-1,1,4a-trimethyl-6-(2-trimethylsilylethynyl)-2,3,4,7,8,8a-hexahydronaphthalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,4aR,8aR)-1,1,4a-trimethyl-6-(2-trimethylsilylethynyl)-2,3,4,7,8,8a-hexahydronaphthalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 155933466 |
| Molecular Formula | C24H44OSi2 |
| Molecular Weight | 404.79 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | [(2S,4aR,8aR)-1,1,4a-trimethyl-6-(2-trimethylsilylethynyl)-2,3,4,7,8,8a-hexahydronaphthalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)C=C(C#C[Si](C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C24H44OSi2/c1-22(2,3)27(10,11)25-21-14-16-24(6)18-19(15-17-26(7,8)9)12-13-20(24)23(21,4)5/h18,20-21H,12-14,16H2,1-11H3/t20-,21-,24+/m0/s1 |
| InChIKey | FUFLPUGRJFPZBE-AWRGLXIESA-N |
| XLogP | 7.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.79 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|