C25H46OSi — CID 11749629
tert-butyl-[[(1S,2S,4S,5S)-4-[2-[(1R)-1,3-dimethylcyclopent-2-en-1-yl]ethyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane (PubChem CID 11749629) has the molecular formula C25H46OSi and a molecular weight of 390.73 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,4S,5S)-4-[2-[(1R)-1,3-dimethylcyclopent-2-en-1-yl]ethyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S,4S,5S)-4-[2-[(1R)-1,3-dimethylcyclopent-2-en-1-yl]ethyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11749629 |
| Molecular Formula | C25H46OSi |
| Molecular Weight | 390.73 g/mol |
| Exact Mass | 390.33 |
| IUPAC Name | tert-butyl-[[(1S,2S,4S,5S)-4-[2-[(1R)-1,3-dimethylcyclopent-2-en-1-yl]ethyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane |
| SMILES | CC1=C[C@@](C)(CC[C@@]2(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]2C3(C)C)CC1 |
| InChI | InChI=1S/C25H46OSi/c1-18-11-12-24(7,16-18)13-14-25(8)17-20(19-15-21(25)23(19,5)6)26-27(9,10)22(2,3)4/h16,19-21H,11-15,17H2,1-10H3/t19-,20+,21-,24-,25+/m1/s1 |
| InChIKey | QJPABVCJADYKEC-RMWGXBEESA-N |
| XLogP | 7.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.73 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|