C17H30OSi — CID 134997545
trimethyl-[[(1'S,2'S,5'R)-2',6',6'-trimethylspiro[2H-furan-5,3'-bicyclo[3.1.1]heptane]-2-yl]methyl]silane (PubChem CID 134997545) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is trimethyl-[[(1'S,2'S,5'R)-2',6',6'-trimethylspiro[2H-furan-5,3'-bicyclo[3.1.1]heptane]-2-yl]methyl]silane.
| Compound Name | trimethyl-[[(1'S,2'S,5'R)-2',6',6'-trimethylspiro[2H-furan-5,3'-bicyclo[3.1.1]heptane]-2-yl]methyl]silane |
|---|---|
| PubChem CID | 134997545 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | trimethyl-[[(1'S,2'S,5'R)-2',6',6'-trimethylspiro[2H-furan-5,3'-bicyclo[3.1.1]heptane]-2-yl]methyl]silane |
| SMILES | C[C@H]1[C@@H]2C[C@H](CC13C=CC(C[Si](C)(C)C)O3)C2(C)C |
| InChI | InChI=1S/C17H30OSi/c1-12-15-9-13(16(15,2)3)10-17(12)8-7-14(18-17)11-19(4,5)6/h7-8,12-15H,9-11H2,1-6H3/t12-,13+,14?,15-,17?/m0/s1 |
| InChIKey | LNQSMLVXTIOUDM-AQPXSAIXSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|