C26H50OSi — CID 134865393
tert-butyl-[[(1S,2S,4S,5S)-4-[(3S)-3,7-dimethyloct-6-enyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane (PubChem CID 134865393) has the molecular formula C26H50OSi and a molecular weight of 406.77 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,4S,5S)-4-[(3S)-3,7-dimethyloct-6-enyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S,4S,5S)-4-[(3S)-3,7-dimethyloct-6-enyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 134865393 |
| Molecular Formula | C26H50OSi |
| Molecular Weight | 406.77 g/mol |
| Exact Mass | 406.36 |
| IUPAC Name | tert-butyl-[[(1S,2S,4S,5S)-4-[(3S)-3,7-dimethyloct-6-enyl]-4,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]oxy]-dimethylsilane |
| SMILES | CC(C)=CCC[C@H](C)CC[C@@]1(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C26H50OSi/c1-19(2)13-12-14-20(3)15-16-26(9)18-22(21-17-23(26)25(21,7)8)27-28(10,11)24(4,5)6/h13,20-23H,12,14-18H2,1-11H3/t20-,21+,22-,23+,26-/m0/s1 |
| InChIKey | BIAAZIWNPCABME-AIDKGEFFSA-N |
| XLogP | 8.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.77 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|