C17H29O2Si — CID 18709878
CID 18709878 (PubChem CID 18709878) has the molecular formula C17H29O2Si and a molecular weight of 293.50 g/mol.
| Compound Name | CID 18709878 |
|---|---|
| PubChem CID | 18709878 |
| Molecular Formula | C17H29O2Si |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | — |
| SMILES | C=[Si]OC1CCC2=CC(O)C(C(C)(C)C)CC2(C)C1C |
| InChI | InChI=1S/C17H29O2Si/c1-11-15(19-20-6)8-7-12-9-14(18)13(16(2,3)4)10-17(11,12)5/h9,11,13-15,18H,6-8,10H2,1-5H3 |
| InChIKey | FEYWUQPWZPCGCA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|