C29H50O4Si — CID 134942754
2-[(2R,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-3-prop-2-ynyl-7-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]ethanol (PubChem CID 134942754) has the molecular formula C29H50O4Si and a molecular weight of 490.80 g/mol. Its IUPAC name is 2-[(2R,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-3-prop-2-ynyl-7-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]ethanol.
| Compound Name | 2-[(2R,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-3-prop-2-ynyl-7-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]ethanol |
|---|---|
| PubChem CID | 134942754 |
| Molecular Formula | C29H50O4Si |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | 2-[(2R,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-3-prop-2-ynyl-7-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]ethanol |
| SMILES | C#CC[C@H]1O[C@@H]([C@]2(C)O[C@@H]2CCO)[C@@H]2[C@@H]([C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)CC=C(C)[C@@H]21 |
| InChI | InChI=1S/C29H50O4Si/c1-11-12-24-26-21(8)13-14-23(27(26)28(32-24)29(10)25(33-29)15-16-30)22(9)17-31-34(18(2)3,19(4)5)20(6)7/h1,13,18-20,22-28,30H,12,14-17H2,2-10H3/t22-,23-,24-,25-,26-,27-,28-,29-/m1/s1 |
| InChIKey | ZHJFDSNUWJSXET-UBYQUXONSA-N |
| XLogP | 6.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|