C18H30O2Si — CID 134959690
[(2R,3R,4Z)-2-[(1R,5R)-2-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-4-(trimethylsilylmethylidene)oxolan-3-yl]methanol (PubChem CID 134959690) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is [(2R,3R,4Z)-2-[(1R,5R)-2-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-4-(trimethylsilylmethylidene)oxolan-3-yl]methanol.
| Compound Name | [(2R,3R,4Z)-2-[(1R,5R)-2-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-4-(trimethylsilylmethylidene)oxolan-3-yl]methanol |
|---|---|
| PubChem CID | 134959690 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | [(2R,3R,4Z)-2-[(1R,5R)-2-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-4-(trimethylsilylmethylidene)oxolan-3-yl]methanol |
| SMILES | C=C(C)[C@@H]1CC=C(C)[C@@H]1[C@H]1OC/C(=C\[Si](C)(C)C)[C@@H]1CO |
| InChI | InChI=1S/C18H30O2Si/c1-12(2)15-8-7-13(3)17(15)18-16(9-19)14(10-20-18)11-21(4,5)6/h7,11,15-19H,1,8-10H2,2-6H3/b14-11+/t15-,16-,17-,18-/m0/s1 |
| InChIKey | WUOXWFFXPZBOBT-PHZANAKRSA-N |
| XLogP | 3.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|