C18H28O2Si — CID 134959692
(3Z,3aR,4R,6aR,9aR,9bR)-9-methyl-6-methylidene-3-(trimethylsilylmethylidene)-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-ol (PubChem CID 134959692) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is (3Z,3aR,4R,6aR,9aR,9bR)-9-methyl-6-methylidene-3-(trimethylsilylmethylidene)-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-ol.
| Compound Name | (3Z,3aR,4R,6aR,9aR,9bR)-9-methyl-6-methylidene-3-(trimethylsilylmethylidene)-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-ol |
|---|---|
| PubChem CID | 134959692 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (3Z,3aR,4R,6aR,9aR,9bR)-9-methyl-6-methylidene-3-(trimethylsilylmethylidene)-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-ol |
| SMILES | C=C1C[C@@H](O)[C@H]2/C(=C/[Si](C)(C)C)CO[C@@H]2[C@H]2C(C)=CC[C@@H]12 |
| InChI | InChI=1S/C18H28O2Si/c1-11-6-7-14-12(2)8-15(19)17-13(10-21(3,4)5)9-20-18(17)16(11)14/h6,10,14-19H,2,7-9H2,1,3-5H3/b13-10+/t14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | KHDOSYYSFHDNKD-GWIJADOHSA-N |
| XLogP | 3.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|