C22H36O3Si — CID 102371775
[(2S,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]methanol (PubChem CID 102371775) has the molecular formula C22H36O3Si and a molecular weight of 376.61 g/mol. Its IUPAC name is [(2S,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]methanol.
| Compound Name | [(2S,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 102371775 |
| Molecular Formula | C22H36O3Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | [(2S,3R)-3-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]-3-methyloxiran-2-yl]methanol |
| SMILES | CC1=CC[C@H](C(C)C)[C@@H]2[C@H]1[C@@H](CC#C[Si](C)(C)C)O[C@H]2[C@@]1(C)O[C@H]1CO |
| InChI | InChI=1S/C22H36O3Si/c1-14(2)16-11-10-15(3)19-17(9-8-12-26(5,6)7)24-21(20(16)19)22(4)18(13-23)25-22/h10,14,16-21,23H,9,11,13H2,1-7H3/t16-,17-,18+,19-,20-,21-,22+/m1/s1 |
| InChIKey | XFWANOKOUJAHFP-FFFWSKEGSA-N |
| XLogP | 4.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|