C24H40OSi — CID 138981517
3-[(1S,3aR,6R,7aR)-3a-methyl-6-prop-1-en-2-yl-3,6,7,7a-tetrahydro-1H-2-benzofuran-1-yl]prop-1-ynyl-tri(propan-2-yl)silane (PubChem CID 138981517) has the molecular formula C24H40OSi and a molecular weight of 372.67 g/mol. Its IUPAC name is 3-[(1S,3aR,6R,7aR)-3a-methyl-6-prop-1-en-2-yl-3,6,7,7a-tetrahydro-1H-2-benzofuran-1-yl]prop-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 3-[(1S,3aR,6R,7aR)-3a-methyl-6-prop-1-en-2-yl-3,6,7,7a-tetrahydro-1H-2-benzofuran-1-yl]prop-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 138981517 |
| Molecular Formula | C24H40OSi |
| Molecular Weight | 372.67 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | 3-[(1S,3aR,6R,7aR)-3a-methyl-6-prop-1-en-2-yl-3,6,7,7a-tetrahydro-1H-2-benzofuran-1-yl]prop-1-ynyl-tri(propan-2-yl)silane |
| SMILES | C=C(C)[C@H]1C=C[C@@]2(C)CO[C@@H](CC#C[Si](C(C)C)(C(C)C)C(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C24H40OSi/c1-17(2)21-12-13-24(9)16-25-23(22(24)15-21)11-10-14-26(18(3)4,19(5)6)20(7)8/h12-13,18-23H,1,11,15-16H2,2-9H3/t21-,22-,23-,24-/m0/s1 |
| InChIKey | GABIIINEJIVMCJ-ZJZGAYNASA-N |
| XLogP | 6.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|