C20H30O2 — CID 11208878
(Z)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]pent-3-en-1-ol (PubChem CID 11208878) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (Z)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]pent-3-en-1-ol.
| Compound Name | (Z)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]pent-3-en-1-ol |
|---|---|
| PubChem CID | 11208878 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (Z)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-prop-2-ynyl-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]pent-3-en-1-ol |
| SMILES | C#CC[C@H]1O[C@@H](/C(C)=C\CCO)[C@H]2[C@@H]1C(C)=CC[C@@H]2C(C)C |
| InChI | InChI=1S/C20H30O2/c1-6-8-17-18-14(4)10-11-16(13(2)3)19(18)20(22-17)15(5)9-7-12-21/h1,9-10,13,16-21H,7-8,11-12H2,2-5H3/b15-9-/t16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | NJMXWIKKAGQGLJ-VPRYQKAGSA-N |
| XLogP | 3.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|