C20H32O3 — CID 102371789
(1S,2R,4S,7R,8R,9R,10R,14S)-3,7,13-trimethyl-10-propan-2-yl-15,16-dioxatetracyclo[6.6.1.12,7.09,14]hexadec-12-en-4-ol (PubChem CID 102371789) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1S,2R,4S,7R,8R,9R,10R,14S)-3,7,13-trimethyl-10-propan-2-yl-15,16-dioxatetracyclo[6.6.1.12,7.09,14]hexadec-12-en-4-ol.
| Compound Name | (1S,2R,4S,7R,8R,9R,10R,14S)-3,7,13-trimethyl-10-propan-2-yl-15,16-dioxatetracyclo[6.6.1.12,7.09,14]hexadec-12-en-4-ol |
|---|---|
| PubChem CID | 102371789 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1S,2R,4S,7R,8R,9R,10R,14S)-3,7,13-trimethyl-10-propan-2-yl-15,16-dioxatetracyclo[6.6.1.12,7.09,14]hexadec-12-en-4-ol |
| SMILES | CC1=CC[C@H](C(C)C)[C@@H]2[C@@H]1[C@@H]1O[C@H]2[C@@]2(C)CC[C@H](O)C(C)[C@H]1O2 |
| InChI | InChI=1S/C20H32O3/c1-10(2)13-7-6-11(3)15-16(13)19-20(5)9-8-14(21)12(4)17(23-20)18(15)22-19/h6,10,12-19,21H,7-9H2,1-5H3/t12?,13-,14+,15-,16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | LTTZLFAEPVRWBI-BZANGLAESA-N |
| XLogP | 3.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|