C30H58O3Si2 — CID 10885864
(3E,5R,6R,7R,8R,9S,11E)-8,13-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9,11-pentamethyltrideca-3,11-dien-1-yn-6-ol (PubChem CID 10885864) has the molecular formula C30H58O3Si2 and a molecular weight of 522.96 g/mol. Its IUPAC name is (3E,5R,6R,7R,8R,9S,11E)-8,13-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9,11-pentamethyltrideca-3,11-dien-1-yn-6-ol.
| Compound Name | (3E,5R,6R,7R,8R,9S,11E)-8,13-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9,11-pentamethyltrideca-3,11-dien-1-yn-6-ol |
|---|---|
| PubChem CID | 10885864 |
| Molecular Formula | C30H58O3Si2 |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.39 |
| IUPAC Name | (3E,5R,6R,7R,8R,9S,11E)-8,13-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9,11-pentamethyltrideca-3,11-dien-1-yn-6-ol |
| SMILES | C#C/C(C)=C/[C@@H](C)[C@@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58O3Si2/c1-17-22(2)20-24(4)27(31)26(6)28(33-35(15,16)30(10,11)12)25(5)21-23(3)18-19-32-34(13,14)29(7,8)9/h1,18,20,24-28,31H,19,21H2,2-16H3/b22-20+,23-18+/t24-,25+,26-,27-,28-/m1/s1 |
| InChIKey | XNPIOGDZXOVTLX-FQYDAFFWSA-N |
| XLogP | 8.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|