C25H44O2Si — CID 135068230
(2Z,6E,10S)-10-[(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-3,7,10-trimethylcyclododeca-2,6-dien-11-yn-1-ol (PubChem CID 135068230) has the molecular formula C25H44O2Si and a molecular weight of 404.71 g/mol. Its IUPAC name is (2Z,6E,10S)-10-[(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-3,7,10-trimethylcyclododeca-2,6-dien-11-yn-1-ol.
| Compound Name | (2Z,6E,10S)-10-[(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-3,7,10-trimethylcyclododeca-2,6-dien-11-yn-1-ol |
|---|---|
| PubChem CID | 135068230 |
| Molecular Formula | C25H44O2Si |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (2Z,6E,10S)-10-[(2R)-4-[tert-butyl(dimethyl)silyl]oxybutan-2-yl]-3,7,10-trimethylcyclododeca-2,6-dien-11-yn-1-ol |
| SMILES | C/C1=C/C(O)C#C[C@](C)([C@H](C)CCO[Si](C)(C)C(C)(C)C)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C25H44O2Si/c1-20-11-10-12-21(2)19-23(26)14-17-25(7,16-13-20)22(3)15-18-27-28(8,9)24(4,5)6/h11,19,22-23,26H,10,12-13,15-16,18H2,1-9H3/b20-11+,21-19-/t22-,23?,25-/m1/s1 |
| InChIKey | GMZQSHPUDHRRRS-YBMQKQARSA-N |
| XLogP | 6.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|