C18H30O3Si — CID 11056381
(4S)-1-[(E)-5-hydroxy-3-methylpent-3-en-1-ynyl]-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-ol (PubChem CID 11056381) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is (4S)-1-[(E)-5-hydroxy-3-methylpent-3-en-1-ynyl]-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-ol.
| Compound Name | (4S)-1-[(E)-5-hydroxy-3-methylpent-3-en-1-ynyl]-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 11056381 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (4S)-1-[(E)-5-hydroxy-3-methylpent-3-en-1-ynyl]-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-ol |
| SMILES | CC1=C[C@@H](O[Si](C)(C)C)CC(C)(C)C1(O)C#C/C(C)=C/CO |
| InChI | InChI=1S/C18H30O3Si/c1-14(9-11-19)8-10-18(20)15(2)12-16(13-17(18,3)4)21-22(5,6)7/h9,12,16,19-20H,11,13H2,1-7H3/b14-9+/t16-,18?/m1/s1 |
| InChIKey | LMGMQSSIWQTHSO-UFLMXCLVSA-N |
| XLogP | 3.26 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|