C20H32O4 — CID 14702779
(8R,9S)-9-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]-3,3,8,10,10-pentamethyl-1,5-dioxaspiro[5.5]undecan-9-ol (PubChem CID 14702779) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (8R,9S)-9-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]-3,3,8,10,10-pentamethyl-1,5-dioxaspiro[5.5]undecan-9-ol.
| Compound Name | (8R,9S)-9-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]-3,3,8,10,10-pentamethyl-1,5-dioxaspiro[5.5]undecan-9-ol |
|---|---|
| PubChem CID | 14702779 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (8R,9S)-9-[(Z)-5-hydroxy-3-methylpent-3-en-1-ynyl]-3,3,8,10,10-pentamethyl-1,5-dioxaspiro[5.5]undecan-9-ol |
| SMILES | C/C(C#C[C@]1(O)[C@H](C)CC2(CC1(C)C)OCC(C)(C)CO2)=C/CO |
| InChI | InChI=1S/C20H32O4/c1-15(8-10-21)7-9-20(22)16(2)11-19(12-18(20,5)6)23-13-17(3,4)14-24-19/h8,16,21-22H,10-14H2,1-6H3/b15-8-/t16-,20+/m1/s1 |
| InChIKey | DCROCWCOKULWSM-KTLSDISLSA-N |
| XLogP | 2.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|