C16H30OSi — CID 13212258
(E)-1-(4-tert-butylcyclohexen-1-yl)-3-trimethylsilylprop-2-en-1-ol (PubChem CID 13212258) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is (E)-1-(4-tert-butylcyclohexen-1-yl)-3-trimethylsilylprop-2-en-1-ol.
| Compound Name | (E)-1-(4-tert-butylcyclohexen-1-yl)-3-trimethylsilylprop-2-en-1-ol |
|---|---|
| PubChem CID | 13212258 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | (E)-1-(4-tert-butylcyclohexen-1-yl)-3-trimethylsilylprop-2-en-1-ol |
| SMILES | CC(C)(C)C1CC=C(C(O)/C=C/[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C16H30OSi/c1-16(2,3)14-9-7-13(8-10-14)15(17)11-12-18(4,5)6/h7,11-12,14-15,17H,8-10H2,1-6H3/b12-11+ |
| InChIKey | VOPBLWKTQDACCI-VAWYXSNFSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|