C29H54O2Si2 — CID 134945475
triethyl-[(1R,5R)-2-methyl-5-prop-1-en-2-yl-1-prop-2-ynyl-3-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl]oxysilane (PubChem CID 134945475) has the molecular formula C29H54O2Si2 and a molecular weight of 490.92 g/mol. Its IUPAC name is triethyl-[(1R,5R)-2-methyl-5-prop-1-en-2-yl-1-prop-2-ynyl-3-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl]oxysilane.
| Compound Name | triethyl-[(1R,5R)-2-methyl-5-prop-1-en-2-yl-1-prop-2-ynyl-3-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 134945475 |
| Molecular Formula | C29H54O2Si2 |
| Molecular Weight | 490.92 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | triethyl-[(1R,5R)-2-methyl-5-prop-1-en-2-yl-1-prop-2-ynyl-3-[tri(propan-2-yl)silyloxymethyl]cyclohex-2-en-1-yl]oxysilane |
| SMILES | C#CC[C@]1(O[Si](CC)(CC)CC)C[C@H](C(=C)C)CC(CO[Si](C(C)C)(C(C)C)C(C)C)=C1C |
| InChI | InChI=1S/C29H54O2Si2/c1-14-18-29(31-32(15-2,16-3)17-4)20-27(22(5)6)19-28(26(29)13)21-30-33(23(7)8,24(9)10)25(11)12/h1,23-25,27H,5,15-21H2,2-4,6-13H3/t27-,29+/m1/s1 |
| InChIKey | VNBLQXZJFSBQNG-PXJZQJOASA-N |
| XLogP | 9.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.92 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|