C24H46O2Si2 — CID 14060264
trimethyl-[2-[(1R,6R)-4-methyl-6-[2-tri(propan-2-yl)silyloxyethynyl]cyclohex-3-en-1-yl]propan-2-yloxy]silane (PubChem CID 14060264) has the molecular formula C24H46O2Si2 and a molecular weight of 422.80 g/mol. Its IUPAC name is trimethyl-[2-[(1R,6R)-4-methyl-6-[2-tri(propan-2-yl)silyloxyethynyl]cyclohex-3-en-1-yl]propan-2-yloxy]silane.
| Compound Name | trimethyl-[2-[(1R,6R)-4-methyl-6-[2-tri(propan-2-yl)silyloxyethynyl]cyclohex-3-en-1-yl]propan-2-yloxy]silane |
|---|---|
| PubChem CID | 14060264 |
| Molecular Formula | C24H46O2Si2 |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | trimethyl-[2-[(1R,6R)-4-methyl-6-[2-tri(propan-2-yl)silyloxyethynyl]cyclohex-3-en-1-yl]propan-2-yloxy]silane |
| SMILES | CC1=CC[C@@H](C(C)(C)O[Si](C)(C)C)[C@H](C#CO[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C24H46O2Si2/c1-18(2)28(19(3)4,20(5)6)25-16-15-22-17-21(7)13-14-23(22)24(8,9)26-27(10,11)12/h13,18-20,22-23H,14,17H2,1-12H3/t22-,23-/m1/s1 |
| InChIKey | VCRCODMEQDKDPD-DHIUTWEWSA-N |
| XLogP | 7.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|