C24H48O2Si2 — CID 132510973
triethyl-[(3R,6S)-3-methyl-6-[(2S)-6-methyl-2-trimethylsilyloxyhept-5-en-2-yl]cyclohexen-1-yl]oxysilane (PubChem CID 132510973) has the molecular formula C24H48O2Si2 and a molecular weight of 424.82 g/mol. Its IUPAC name is triethyl-[(3R,6S)-3-methyl-6-[(2S)-6-methyl-2-trimethylsilyloxyhept-5-en-2-yl]cyclohexen-1-yl]oxysilane.
| Compound Name | triethyl-[(3R,6S)-3-methyl-6-[(2S)-6-methyl-2-trimethylsilyloxyhept-5-en-2-yl]cyclohexen-1-yl]oxysilane |
|---|---|
| PubChem CID | 132510973 |
| Molecular Formula | C24H48O2Si2 |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | triethyl-[(3R,6S)-3-methyl-6-[(2S)-6-methyl-2-trimethylsilyloxyhept-5-en-2-yl]cyclohexen-1-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)OC1=C[C@H](C)CC[C@H]1[C@](C)(CCC=C(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H48O2Si2/c1-11-28(12-2,13-3)25-23-19-21(6)16-17-22(23)24(7,26-27(8,9)10)18-14-15-20(4)5/h15,19,21-22H,11-14,16-18H2,1-10H3/t21-,22-,24+/m1/s1 |
| InChIKey | TYCXCPVLWOBJEJ-AKFKNWHVSA-N |
| XLogP | 8.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|