C30H58O2Si2 — CID 18636592
tert-butyl-[2-cyclohexyl-4-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]butan-2-yl]oxy-dimethylsilane (PubChem CID 18636592) has the molecular formula C30H58O2Si2 and a molecular weight of 506.96 g/mol. Its IUPAC name is tert-butyl-[2-cyclohexyl-4-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]butan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[2-cyclohexyl-4-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]butan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 18636592 |
| Molecular Formula | C30H58O2Si2 |
| Molecular Weight | 506.96 g/mol |
| Exact Mass | 506.40 |
| IUPAC Name | tert-butyl-[2-cyclohexyl-4-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]butan-2-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H]1C(CCC(C)(O[Si](C)(C)C(C)(C)C)C2CCCCC2)=CC[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H58O2Si2/c1-11-18-27-25(21-22-28(27)31-34(12-2,13-3)14-4)23-24-30(8,26-19-16-15-17-20-26)32-33(9,10)29(5,6)7/h11,21,26-28H,1,12-20,22-24H2,2-10H3/t27-,28+,30?/m1/s1 |
| InChIKey | LLYHMNAUIFKAMX-FBMPGHKGSA-N |
| XLogP | 10.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.96 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|