C24H50O2Si2 — CID 135025444
tert-butyl-[(1S,2Z,3R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-methyl-6-propan-2-ylcyclohexyl]oxy-dimethylsilane (PubChem CID 135025444) has the molecular formula C24H50O2Si2 and a molecular weight of 426.83 g/mol. Its IUPAC name is tert-butyl-[(1S,2Z,3R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-methyl-6-propan-2-ylcyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2Z,3R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-methyl-6-propan-2-ylcyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 135025444 |
| Molecular Formula | C24H50O2Si2 |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | tert-butyl-[(1S,2Z,3R,6S)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-3-methyl-6-propan-2-ylcyclohexyl]oxy-dimethylsilane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)/C(=C/CO[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O2Si2/c1-18(2)20-15-14-19(3)21(16-17-25-27(10,11)23(4,5)6)22(20)26-28(12,13)24(7,8)9/h16,18-20,22H,14-15,17H2,1-13H3/b21-16-/t19-,20+,22+/m1/s1 |
| InChIKey | LYACKRUIJLSCSV-URXIOOCVSA-N |
| XLogP | 8.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|