C20H40OSi2 — CID 11710082
tert-butyl-[(4S)-4,8-dimethyl-1-trimethylsilylnon-7-en-1-yn-4-yl]oxy-dimethylsilane (PubChem CID 11710082) has the molecular formula C20H40OSi2 and a molecular weight of 352.71 g/mol. Its IUPAC name is tert-butyl-[(4S)-4,8-dimethyl-1-trimethylsilylnon-7-en-1-yn-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4S)-4,8-dimethyl-1-trimethylsilylnon-7-en-1-yn-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11710082 |
| Molecular Formula | C20H40OSi2 |
| Molecular Weight | 352.71 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | tert-butyl-[(4S)-4,8-dimethyl-1-trimethylsilylnon-7-en-1-yn-4-yl]oxy-dimethylsilane |
| SMILES | CC(C)=CCC[C@@](C)(CC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40OSi2/c1-18(2)14-12-15-20(6,16-13-17-22(7,8)9)21-23(10,11)19(3,4)5/h14H,12,15-16H2,1-11H3/t20-/m0/s1 |
| InChIKey | GCNWNIPEDWGYRD-FQEVSTJZSA-N |
| XLogP | 6.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.71 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|