C20H36O2Si — CID 134853146
[6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]methanol (PubChem CID 134853146) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is [6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]methanol.
| Compound Name | [6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]methanol |
|---|---|
| PubChem CID | 134853146 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | [6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyhexyl]cyclohepta-1,3,5-trien-1-yl]methanol |
| SMILES | CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)C1=CC=CC=C(CO)C1 |
| InChI | InChI=1S/C20H36O2Si/c1-7-8-9-14-19(22-23(5,6)20(2,3)4)18-13-11-10-12-17(15-18)16-21/h10-13,19,21H,7-9,14-16H2,1-6H3/t19-/m1/s1 |
| InChIKey | PZXXETCQICVNBJ-LJQANCHMSA-N |
| XLogP | 5.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|