C14H30O2Si — CID 13382779
(E)-4-methyl-3-trimethylsilyldec-2-ene-1,4-diol (PubChem CID 13382779) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is (E)-4-methyl-3-trimethylsilyldec-2-ene-1,4-diol.
| Compound Name | (E)-4-methyl-3-trimethylsilyldec-2-ene-1,4-diol |
|---|---|
| PubChem CID | 13382779 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (E)-4-methyl-3-trimethylsilyldec-2-ene-1,4-diol |
| SMILES | CCCCCCC(C)(O)/C(=C\CO)[Si](C)(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-6-7-8-9-11-14(2,16)13(10-12-15)17(3,4)5/h10,15-16H,6-9,11-12H2,1-5H3/b13-10+ |
| InChIKey | LSEBUHZSYPZVNF-JLHYYAGUSA-N |
| XLogP | 3.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|