C13H28O2Si — CID 13382781
(E)-4-propyl-3-trimethylsilylhept-2-ene-1,4-diol (PubChem CID 13382781) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is (E)-4-propyl-3-trimethylsilylhept-2-ene-1,4-diol.
| Compound Name | (E)-4-propyl-3-trimethylsilylhept-2-ene-1,4-diol |
|---|---|
| PubChem CID | 13382781 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (E)-4-propyl-3-trimethylsilylhept-2-ene-1,4-diol |
| SMILES | CCCC(O)(CCC)/C(=C\CO)[Si](C)(C)C |
| InChI | InChI=1S/C13H28O2Si/c1-6-9-13(15,10-7-2)12(8-11-14)16(3,4)5/h8,14-15H,6-7,9-11H2,1-5H3/b12-8+ |
| InChIKey | DWXZRAWPQKUQAZ-XYOKQWHBSA-N |
| XLogP | 3.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|