C18H38O2Si — CID 11709440
(E,5R)-5-methyl-5-tri(propan-2-yl)silyloxyoct-2-en-1-ol (PubChem CID 11709440) has the molecular formula C18H38O2Si and a molecular weight of 314.59 g/mol. Its IUPAC name is (E,5R)-5-methyl-5-tri(propan-2-yl)silyloxyoct-2-en-1-ol.
| Compound Name | (E,5R)-5-methyl-5-tri(propan-2-yl)silyloxyoct-2-en-1-ol |
|---|---|
| PubChem CID | 11709440 |
| Molecular Formula | C18H38O2Si |
| Molecular Weight | 314.59 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (E,5R)-5-methyl-5-tri(propan-2-yl)silyloxyoct-2-en-1-ol |
| SMILES | CCC[C@](C)(C/C=C/CO)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H38O2Si/c1-9-12-18(8,13-10-11-14-19)20-21(15(2)3,16(4)5)17(6)7/h10-11,15-17,19H,9,12-14H2,1-8H3/b11-10+/t18-/m1/s1 |
| InChIKey | HKMHULLAVPBANL-DOJUMQAQSA-N |
| XLogP | 5.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|