C25H50O3Si2 — CID 135013679
(5Z,7S,8S,9E)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,7,10-tetramethyl-3-trimethylsilyldodeca-1,5,9-triene-4,8-diol (PubChem CID 135013679) has the molecular formula C25H50O3Si2 and a molecular weight of 454.84 g/mol. Its IUPAC name is (5Z,7S,8S,9E)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,7,10-tetramethyl-3-trimethylsilyldodeca-1,5,9-triene-4,8-diol.
| Compound Name | (5Z,7S,8S,9E)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,7,10-tetramethyl-3-trimethylsilyldodeca-1,5,9-triene-4,8-diol |
|---|---|
| PubChem CID | 135013679 |
| Molecular Formula | C25H50O3Si2 |
| Molecular Weight | 454.84 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | (5Z,7S,8S,9E)-12-[tert-butyl(dimethyl)silyl]oxy-3,5,7,10-tetramethyl-3-trimethylsilyldodeca-1,5,9-triene-4,8-diol |
| SMILES | C=CC(C)(C(O)/C(C)=C\[C@H](C)[C@H](O)/C=C(\C)CCO[Si](C)(C)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C25H50O3Si2/c1-14-25(8,29(9,10)11)23(27)21(4)18-20(3)22(26)17-19(2)15-16-28-30(12,13)24(5,6)7/h14,17-18,20,22-23,26-27H,1,15-16H2,2-13H3/b19-17+,21-18-/t20-,22+,23?,25?/m0/s1 |
| InChIKey | GDGCDBQBBCIMSF-URHALUOPSA-N |
| XLogP | 6.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.84 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|