C21H42O3Si2 — CID 135032019
2-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]cyclopent-2-en-1-ol (PubChem CID 135032019) has the molecular formula C21H42O3Si2 and a molecular weight of 398.74 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]cyclopent-2-en-1-ol.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 135032019 |
| Molecular Formula | C21H42O3Si2 |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]cyclopent-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/CC1(O)CCC=C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si2/c1-19(2,3)25(7,8)23-17-12-11-15-21(22)16-13-14-18(21)24-26(9,10)20(4,5)6/h11-12,14,22H,13,15-17H2,1-10H3/b12-11+ |
| InChIKey | NAIOYKPQRFFLTO-VAWYXSNFSA-N |
| XLogP | 6.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|