C17H32O2Si2 — CID 86754280
4-[tert-butyl(dimethyl)silyl]oxy-1-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol (PubChem CID 86754280) has the molecular formula C17H32O2Si2 and a molecular weight of 324.61 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-1-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 86754280 |
| Molecular Formula | C17H32O2Si2 |
| Molecular Weight | 324.61 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC1C=CC(O)(CC#C[Si](C)(C)C)C1 |
| InChI | InChI=1S/C17H32O2Si2/c1-16(2,3)21(7,8)19-15-10-12-17(18,14-15)11-9-13-20(4,5)6/h10,12,15,18H,11,14H2,1-8H3 |
| InChIKey | TYMXLFJIALPLCZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|