C11H18O2Si — CID 102380786
(1R,3R)-1-(3-trimethylsilylprop-2-ynyl)cyclopent-4-ene-1,3-diol (PubChem CID 102380786) has the molecular formula C11H18O2Si and a molecular weight of 210.35 g/mol. Its IUPAC name is (1R,3R)-1-(3-trimethylsilylprop-2-ynyl)cyclopent-4-ene-1,3-diol.
| Compound Name | (1R,3R)-1-(3-trimethylsilylprop-2-ynyl)cyclopent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 102380786 |
| Molecular Formula | C11H18O2Si |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (1R,3R)-1-(3-trimethylsilylprop-2-ynyl)cyclopent-4-ene-1,3-diol |
| SMILES | C[Si](C)(C)C#CC[C@]1(O)C=C[C@H](O)C1 |
| InChI | InChI=1S/C11H18O2Si/c1-14(2,3)8-4-6-11(13)7-5-10(12)9-11/h5,7,10,12-13H,6,9H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | JXCQZELQGQODLW-QWRGUYRKSA-N |
| XLogP | 1.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|