C15H28O2Si — CID 57153596
4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-prop-2-enylcyclopent-2-en-1-ol (PubChem CID 57153596) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-prop-2-enylcyclopent-2-en-1-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-prop-2-enylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 57153596 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-prop-2-enylcyclopent-2-en-1-ol |
| SMILES | C=CCC1=CC(O[Si](C)(C)C(C)(C)C)CC1(C)O |
| InChI | InChI=1S/C15H28O2Si/c1-8-9-12-10-13(11-15(12,5)16)17-18(6,7)14(2,3)4/h8,10,13,16H,1,9,11H2,2-7H3 |
| InChIKey | CVPHSXJEPRGXRH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|