C14H28O2Si — CID 11514402
(1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylcyclohex-2-en-1-ol (PubChem CID 11514402) has the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. Its IUPAC name is (1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylcyclohex-2-en-1-ol.
| Compound Name | (1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 11514402 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (1S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methylcyclohex-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CCCC[C@]1(C)O |
| InChI | InChI=1S/C14H28O2Si/c1-13(2,3)17(5,6)16-11-12-9-7-8-10-14(12,4)15/h9,15H,7-8,10-11H2,1-6H3/t14-/m0/s1 |
| InChIKey | WCVLCUMSVLKAFS-AWEZNQCLSA-N |
| XLogP | 3.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|