C14H28O2Si — CID 57032808
4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-1-methylcyclopent-2-en-1-ol (PubChem CID 57032808) has the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-1-methylcyclopent-2-en-1-ol.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-1-methylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 57032808 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-1-methylcyclopent-2-en-1-ol |
| SMILES | CCC1=CC(O[Si](C)(C)C(C)(C)C)CC1(C)O |
| InChI | InChI=1S/C14H28O2Si/c1-8-11-9-12(10-14(11,5)15)16-17(6,7)13(2,3)4/h9,12,15H,8,10H2,1-7H3 |
| InChIKey | MGIYHLXMIYRAEU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|