C14H24O2Si — CID 50901420
(E,3S,5R)-1-cyclopropyl-5-methyl-7-trimethylsilylhept-1-en-6-yne-3,5-diol (PubChem CID 50901420) has the molecular formula C14H24O2Si and a molecular weight of 252.43 g/mol. Its IUPAC name is (E,3S,5R)-1-cyclopropyl-5-methyl-7-trimethylsilylhept-1-en-6-yne-3,5-diol.
| Compound Name | (E,3S,5R)-1-cyclopropyl-5-methyl-7-trimethylsilylhept-1-en-6-yne-3,5-diol |
|---|---|
| PubChem CID | 50901420 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (E,3S,5R)-1-cyclopropyl-5-methyl-7-trimethylsilylhept-1-en-6-yne-3,5-diol |
| SMILES | C[C@](O)(C#C[Si](C)(C)C)C[C@H](O)/C=C/C1CC1 |
| InChI | InChI=1S/C14H24O2Si/c1-14(16,9-10-17(2,3)4)11-13(15)8-7-12-5-6-12/h7-8,12-13,15-16H,5-6,11H2,1-4H3/b8-7+/t13-,14+/m1/s1 |
| InChIKey | RBBZMFGMFGDESW-NCRJZKAISA-N |
| XLogP | 2.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|